C25H29F3N4O3S — CID 170791534
2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclobutyl)-2-oxo-3-pyridinyl]-6-fluoro-4-(2-hydroxyethylsulfanylamino)benzamide (PubChem CID 170791534) has the molecular formula C25H29F3N4O3S and a molecular weight of 522.59 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclobutyl)-2-oxo-3-pyridinyl]-6-fluoro-4-(2-hydroxyethylsulfanylamino)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclobutyl)-2-oxo-3-pyridinyl]-6-fluoro-4-(2-hydroxyethylsulfanylamino)benzamide |
|---|---|
| PubChem CID | 170791534 |
| Molecular Formula | C25H29F3N4O3S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclobutyl)-2-oxo-3-pyridinyl]-6-fluoro-4-(2-hydroxyethylsulfanylamino)benzamide |
| SMILES | O=C(Nc1cccn(C2CC(F)(F)C2)c1=O)c1c(F)cc(NSCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C25H29F3N4O3S/c26-18-12-16(30-36-11-10-33)13-20(31-8-5-24(3-4-24)6-9-31)21(18)22(34)29-19-2-1-7-32(23(19)35)17-14-25(27,28)15-17/h1-2,7,12-13,17,30,33H,3-6,8-11,14-15H2,(H,29,34) |
| InChIKey | ZUWHMEUTAIZGRR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|