C17H13F4N3O4 — CID 170791662
N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-2,6-difluoro-4-nitrobenzamide (PubChem CID 170791662) has the molecular formula C17H13F4N3O4 and a molecular weight of 399.30 g/mol. Its IUPAC name is N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-2,6-difluoro-4-nitrobenzamide.
| Compound Name | N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-2,6-difluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 170791662 |
| Molecular Formula | C17H13F4N3O4 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-2,6-difluoro-4-nitrobenzamide |
| SMILES | O=C(Nc1cccn(C2CCC(F)(F)C2)c1=O)c1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C17H13F4N3O4/c18-11-6-10(24(27)28)7-12(19)14(11)15(25)22-13-2-1-5-23(16(13)26)9-3-4-17(20,21)8-9/h1-2,5-7,9H,3-4,8H2,(H,22,25) |
| InChIKey | SJEFLZDDMZMOKS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|