C25H29F3N6O3 — CID 170950058
N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-[(1S,6S)-6-methyl-3-azabicyclo[4.2.0]octan-3-yl]-4-nitrobenzamide (PubChem CID 170950058) has the molecular formula C25H29F3N6O3 and a molecular weight of 518.54 g/mol. Its IUPAC name is N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-[(1S,6S)-6-methyl-3-azabicyclo[4.2.0]octan-3-yl]-4-nitrobenzamide.
| Compound Name | N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-[(1S,6S)-6-methyl-3-azabicyclo[4.2.0]octan-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 170950058 |
| Molecular Formula | C25H29F3N6O3 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-[(1S,6S)-6-methyl-3-azabicyclo[4.2.0]octan-3-yl]-4-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2c(F)cc([N+](=O)[O-])cc2N2CC[C@]3(C)CC[C@@H]3C2)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C25H29F3N6O3/c1-15-11-20(31-23(29-15)32-9-6-25(27,28)7-10-32)30-22(35)21-18(26)12-17(34(36)37)13-19(21)33-8-5-24(2)4-3-16(24)14-33/h11-13,16H,3-10,14H2,1-2H3,(H,29,30,31,35)/t16-,24+/m1/s1 |
| InChIKey | RKSSCFXTPONIKJ-GYCJOSAFSA-N |
| XLogP | 4.95 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|