C17H16F3N5O3 — CID 170950149
N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-4-nitrobenzamide (PubChem CID 170950149) has the molecular formula C17H16F3N5O3 and a molecular weight of 395.34 g/mol. Its IUPAC name is N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-4-nitrobenzamide.
| Compound Name | N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 170950149 |
| Molecular Formula | C17H16F3N5O3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-4-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2ccc([N+](=O)[O-])cc2F)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C17H16F3N5O3/c1-10-8-14(23-16(21-10)24-6-4-17(19,20)5-7-24)22-15(26)12-3-2-11(25(27)28)9-13(12)18/h2-3,8-9H,4-7H2,1H3,(H,21,22,23,26) |
| InChIKey | QPPCVADHIQFUKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|