C18H21ClN6O3 — CID 121031743
(2-chloro-4-nitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 121031743) has the molecular formula C18H21ClN6O3 and a molecular weight of 404.86 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121031743 |
| Molecular Formula | C18H21ClN6O3 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | CCNc1cc(C)nc(N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)n1 |
| InChI | InChI=1S/C18H21ClN6O3/c1-3-20-16-10-12(2)21-18(22-16)24-8-6-23(7-9-24)17(26)14-5-4-13(25(27)28)11-15(14)19/h4-5,10-11H,3,6-9H2,1-2H3,(H,20,21,22) |
| InChIKey | VJTVAMDPTJOKFV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|