C20H20ClN7O3 — CID 121034170
(2-chloro-4-nitrophenyl)-[4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 121034170) has the molecular formula C20H20ClN7O3 and a molecular weight of 441.88 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121034170 |
| Molecular Formula | C20H20ClN7O3 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(C)n(-c2ccc(N3CCN(C(=O)c4ccc([N+](=O)[O-])cc4Cl)CC3)nn2)n1 |
| InChI | InChI=1S/C20H20ClN7O3/c1-13-11-14(2)27(24-13)19-6-5-18(22-23-19)25-7-9-26(10-8-25)20(29)16-4-3-15(28(30)31)12-17(16)21/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | IKQWQKHEFOXEPE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|