C17H15ClN8O3 — CID 90626618
(2-chloro-4-nitrophenyl)-[4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 90626618) has the molecular formula C17H15ClN8O3 and a molecular weight of 414.81 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 90626618 |
| Molecular Formula | C17H15ClN8O3 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[4-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1Cl)N1CCN(c2cc(-n3cncn3)ncn2)CC1 |
| InChI | InChI=1S/C17H15ClN8O3/c18-14-7-12(26(28)29)1-2-13(14)17(27)24-5-3-23(4-6-24)15-8-16(21-10-20-15)25-11-19-9-22-25/h1-2,7-11H,3-6H2 |
| InChIKey | CRTZRSYNKQBPSA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|