C18H19N7O4 — CID 122339190
[4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 122339190) has the molecular formula C18H19N7O4 and a molecular weight of 397.40 g/mol. Its IUPAC name is [4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 122339190 |
| Molecular Formula | C18H19N7O4 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | Cc1cc(C)n(-c2ccc(N3CCN(C(=O)c4ccc([N+](=O)[O-])o4)CC3)nn2)n1 |
| InChI | InChI=1S/C18H19N7O4/c1-12-11-13(2)24(21-12)16-5-4-15(19-20-16)22-7-9-23(10-8-22)18(26)14-3-6-17(29-14)25(27)28/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | XSXLPETVIWNUEA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|