C18H17N7O4 — CID 122347847
(5-nitrofuran-2-yl)-[4-[6-(pyridin-4-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 122347847) has the molecular formula C18H17N7O4 and a molecular weight of 395.38 g/mol. Its IUPAC name is (5-nitrofuran-2-yl)-[4-[6-(pyridin-4-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (5-nitrofuran-2-yl)-[4-[6-(pyridin-4-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122347847 |
| Molecular Formula | C18H17N7O4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (5-nitrofuran-2-yl)-[4-[6-(pyridin-4-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N1CCN(c2ccc(Nc3ccncc3)nn2)CC1 |
| InChI | InChI=1S/C18H17N7O4/c26-18(14-1-4-17(29-14)25(27)28)24-11-9-23(10-12-24)16-3-2-15(21-22-16)20-13-5-7-19-8-6-13/h1-8H,9-12H2,(H,19,20,21) |
| InChIKey | DMMSVZBGNZDDGM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|