C21H24N6O — CID 122346166
[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-isoquinolin-1-ylmethanone (PubChem CID 122346166) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is [4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 122346166 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-isoquinolin-1-ylmethanone |
| SMILES | CCNc1cc(C)nc(N2CCN(C(=O)c3nccc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C21H24N6O/c1-3-22-18-14-15(2)24-21(25-18)27-12-10-26(11-13-27)20(28)19-17-7-5-4-6-16(17)8-9-23-19/h4-9,14H,3,10-13H2,1-2H3,(H,22,24,25) |
| InChIKey | MRQMTESFXMIEHQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |