C24H28N6O — CID 122333323
isoquinolin-1-yl-[4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methanone (PubChem CID 122333323) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is isoquinolin-1-yl-[4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methanone.
| Compound Name | isoquinolin-1-yl-[4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122333323 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | isoquinolin-1-yl-[4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(N2CCCCC2)nc(N2CCN(C(=O)c3nccc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C24H28N6O/c1-18-17-21(28-11-5-2-6-12-28)27-24(26-18)30-15-13-29(14-16-30)23(31)22-20-8-4-3-7-19(20)9-10-25-22/h3-4,7-10,17H,2,5-6,11-16H2,1H3 |
| InChIKey | VUKFXOFSYWAPMW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |