C19H25N5OS — CID 56700437
[4-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 56700437) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is [4-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 56700437 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [4-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3cccs3)CC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H25N5OS/c1-15-14-17(21-19(20-15)24-7-3-2-4-8-24)22-9-11-23(12-10-22)18(25)16-6-5-13-26-16/h5-6,13-14H,2-4,7-12H2,1H3 |
| InChIKey | WDRUTEDVZOAOIX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |