C18H21N7O5 — CID 121031744
(3,5-dinitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 121031744) has the molecular formula C18H21N7O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (3,5-dinitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121031744 |
| Molecular Formula | C18H21N7O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (3,5-dinitrophenyl)-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | CCNc1cc(C)nc(N2CCN(C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C18H21N7O5/c1-3-19-16-8-12(2)20-18(21-16)23-6-4-22(5-7-23)17(26)13-9-14(24(27)28)11-15(10-13)25(29)30/h8-11H,3-7H2,1-2H3,(H,19,20,21) |
| InChIKey | YRLXBYBXEYNQNM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|