C21H27N5O — CID 122346229
(E)-1-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-3-(2-methylphenyl)prop-2-en-1-one (PubChem CID 122346229) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (E)-1-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-3-(2-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-3-(2-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122346229 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (E)-1-[4-[4-(ethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-3-(2-methylphenyl)prop-2-en-1-one |
| SMILES | CCNc1cc(C)nc(N2CCN(C(=O)/C=C/c3ccccc3C)CC2)n1 |
| InChI | InChI=1S/C21H27N5O/c1-4-22-19-15-17(3)23-21(24-19)26-13-11-25(12-14-26)20(27)10-9-18-8-6-5-7-16(18)2/h5-10,15H,4,11-14H2,1-3H3,(H,22,23,24)/b10-9+ |
| InChIKey | YOUMVWIUKUHWET-MDZDMXLPSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|