C23H30BrF2N5OSi — CID 170950059
4-bromo-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide (PubChem CID 170950059) has the molecular formula C23H30BrF2N5OSi and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-bromo-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide.
| Compound Name | 4-bromo-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide |
|---|---|
| PubChem CID | 170950059 |
| Molecular Formula | C23H30BrF2N5OSi |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 4-bromo-N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(Br)cc2N2CC[Si](C)(C)CC2)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C23H30BrF2N5OSi/c1-16-14-20(29-22(27-16)31-8-6-23(25,26)7-9-31)28-21(32)18-5-4-17(24)15-19(18)30-10-12-33(2,3)13-11-30/h4-5,14-15H,6-13H2,1-3H3,(H,27,28,29,32) |
| InChIKey | XXMGXCCBALTVHM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|