C24H33F2N5OSi — CID 170950299
4-amino-N-[6-(4,4-difluoropiperidin-1-yl)-4-methyl-2-pyridinyl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide (PubChem CID 170950299) has the molecular formula C24H33F2N5OSi and a molecular weight of 473.64 g/mol. Its IUPAC name is 4-amino-N-[6-(4,4-difluoropiperidin-1-yl)-4-methyl-2-pyridinyl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide.
| Compound Name | 4-amino-N-[6-(4,4-difluoropiperidin-1-yl)-4-methyl-2-pyridinyl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide |
|---|---|
| PubChem CID | 170950299 |
| Molecular Formula | C24H33F2N5OSi |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 4-amino-N-[6-(4,4-difluoropiperidin-1-yl)-4-methyl-2-pyridinyl]-2-(4,4-dimethyl-1,4-azasilinan-1-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(N)cc2N2CC[Si](C)(C)CC2)nc(N2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C24H33F2N5OSi/c1-17-14-21(28-22(15-17)31-8-6-24(25,26)7-9-31)29-23(32)19-5-4-18(27)16-20(19)30-10-12-33(2,3)13-11-30/h4-5,14-16H,6-13,27H2,1-3H3,(H,28,29,32) |
| InChIKey | OSJXSTXNIQHIIT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|