C23H27F3N6O3 — CID 170950062
N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-(4-methylpiperidin-1-yl)-4-nitrobenzamide (PubChem CID 170950062) has the molecular formula C23H27F3N6O3 and a molecular weight of 492.50 g/mol. Its IUPAC name is N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-(4-methylpiperidin-1-yl)-4-nitrobenzamide.
| Compound Name | N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-(4-methylpiperidin-1-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 170950062 |
| Molecular Formula | C23H27F3N6O3 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | N-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-2-fluoro-6-(4-methylpiperidin-1-yl)-4-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2c(F)cc([N+](=O)[O-])cc2N2CCC(C)CC2)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C23H27F3N6O3/c1-14-3-7-30(8-4-14)18-13-16(32(34)35)12-17(24)20(18)21(33)28-19-11-15(2)27-22(29-19)31-9-5-23(25,26)6-10-31/h11-14H,3-10H2,1-2H3,(H,27,28,29,33) |
| InChIKey | ZILLVCMBKBIQCA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|