C23H25F3N6O3 — CID 171825068
2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrimidin-2-yl]-6-fluoro-4-nitrobenzamide (PubChem CID 171825068) has the molecular formula C23H25F3N6O3 and a molecular weight of 490.49 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrimidin-2-yl]-6-fluoro-4-nitrobenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrimidin-2-yl]-6-fluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 171825068 |
| Molecular Formula | C23H25F3N6O3 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[4-(4,4-difluoropiperidin-1-yl)pyrimidin-2-yl]-6-fluoro-4-nitrobenzamide |
| SMILES | O=C(Nc1nccc(N2CCC(F)(F)CC2)n1)c1c(F)cc([N+](=O)[O-])cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C23H25F3N6O3/c24-16-13-15(32(34)35)14-17(30-9-4-22(2-3-22)5-10-30)19(16)20(33)29-21-27-8-1-18(28-21)31-11-6-23(25,26)7-12-31/h1,8,13-14H,2-7,9-12H2,(H,27,28,29,33) |
| InChIKey | LJHUPQHXWHEIMX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|