C26H28F2N6O2 — CID 169266548
6-[2-[5-[6-(4,4-difluoropiperidin-1-yl)-2-pyridinyl]-1H-imidazol-2-yl]-5-nitrophenyl]-6-azaspiro[2.5]octane (PubChem CID 169266548) has the molecular formula C26H28F2N6O2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 6-[2-[5-[6-(4,4-difluoropiperidin-1-yl)-2-pyridinyl]-1H-imidazol-2-yl]-5-nitrophenyl]-6-azaspiro[2.5]octane.
| Compound Name | 6-[2-[5-[6-(4,4-difluoropiperidin-1-yl)-2-pyridinyl]-1H-imidazol-2-yl]-5-nitrophenyl]-6-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 169266548 |
| Molecular Formula | C26H28F2N6O2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 6-[2-[5-[6-(4,4-difluoropiperidin-1-yl)-2-pyridinyl]-1H-imidazol-2-yl]-5-nitrophenyl]-6-azaspiro[2.5]octane |
| SMILES | O=[N+]([O-])c1ccc(-c2ncc(-c3cccc(N4CCC(F)(F)CC4)n3)[nH]2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C26H28F2N6O2/c27-26(28)10-14-33(15-11-26)23-3-1-2-20(30-23)21-17-29-24(31-21)19-5-4-18(34(35)36)16-22(19)32-12-8-25(6-7-25)9-13-32/h1-5,16-17H,6-15H2,(H,29,31) |
| InChIKey | JLIZXSZZVVWUAG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|