C12H10F3N3O2 — CID 170563422
3-(4,4-difluoropiperidin-1-yl)-2-fluoro-5-nitrobenzonitrile (PubChem CID 170563422) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-1-yl)-2-fluoro-5-nitrobenzonitrile.
| Compound Name | 3-(4,4-difluoropiperidin-1-yl)-2-fluoro-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 170563422 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-(4,4-difluoropiperidin-1-yl)-2-fluoro-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cc(N2CCC(F)(F)CC2)c1F |
| InChI | InChI=1S/C12H10F3N3O2/c13-11-8(7-16)5-9(18(19)20)6-10(11)17-3-1-12(14,15)2-4-17/h5-6H,1-4H2 |
| InChIKey | JPPUEXFONHYFLN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|