C12H11BrF2N2 — CID 86811090
5-bromo-2-(4,4-difluoropiperidin-1-yl)benzonitrile (PubChem CID 86811090) has the molecular formula C12H11BrF2N2 and a molecular weight of 301.13 g/mol. Its IUPAC name is 5-bromo-2-(4,4-difluoropiperidin-1-yl)benzonitrile.
| Compound Name | 5-bromo-2-(4,4-difluoropiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 86811090 |
| Molecular Formula | C12H11BrF2N2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 5-bromo-2-(4,4-difluoropiperidin-1-yl)benzonitrile |
| SMILES | N#Cc1cc(Br)ccc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H11BrF2N2/c13-10-1-2-11(9(7-10)8-16)17-5-3-12(14,15)4-6-17/h1-2,7H,3-6H2 |
| InChIKey | QJIPKBFALRFXSF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |