C18H17F2N3O4 — CID 86780953
1-(2,6-difluoro-4-nitrophenyl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 86780953) has the molecular formula C18H17F2N3O4 and a molecular weight of 377.35 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-nitrophenyl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,6-difluoro-4-nitrophenyl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86780953 |
| Molecular Formula | C18H17F2N3O4 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-(2,6-difluoro-4-nitrophenyl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1CCN(c2c(F)cc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C18H17F2N3O4/c19-15-9-13(23(26)27)10-16(20)17(15)22-7-5-11(6-8-22)18(25)21-12-1-3-14(24)4-2-12/h1-4,9-11,24H,5-8H2,(H,21,25) |
| InChIKey | ILPCAZJQVOQFNG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|