C19H12F2N2O5 — CID 19836482
N-(2,4-difluorophenyl)-6-methyl-2-(3-nitrophenyl)-4-oxopyran-3-carboxamide (PubChem CID 19836482) has the molecular formula C19H12F2N2O5 and a molecular weight of 386.31 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-6-methyl-2-(3-nitrophenyl)-4-oxopyran-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-6-methyl-2-(3-nitrophenyl)-4-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 19836482 |
| Molecular Formula | C19H12F2N2O5 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-(2,4-difluorophenyl)-6-methyl-2-(3-nitrophenyl)-4-oxopyran-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccc(F)cc2F)c(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C19H12F2N2O5/c1-10-7-16(24)17(19(25)22-15-6-5-12(20)9-14(15)21)18(28-10)11-3-2-4-13(8-11)23(26)27/h2-9H,1H3,(H,22,25) |
| InChIKey | ZOCFZOMJUZTMGP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|