C25H31F2N5O2S — CID 170791186
2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-4-(methylaminosulfanylamino)benzamide (PubChem CID 170791186) has the molecular formula C25H31F2N5O2S and a molecular weight of 503.62 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-4-(methylaminosulfanylamino)benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-4-(methylaminosulfanylamino)benzamide |
|---|---|
| PubChem CID | 170791186 |
| Molecular Formula | C25H31F2N5O2S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[1-(3,3-difluorocyclopentyl)-2-oxo-3-pyridinyl]-4-(methylaminosulfanylamino)benzamide |
| SMILES | CNSNc1ccc(C(=O)Nc2cccn(C3CCC(F)(F)C3)c2=O)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C25H31F2N5O2S/c1-28-35-30-17-4-5-19(21(15-17)31-13-10-24(8-9-24)11-14-31)22(33)29-20-3-2-12-32(23(20)34)18-6-7-25(26,27)16-18/h2-5,12,15,18,28,30H,6-11,13-14,16H2,1H3,(H,29,33) |
| InChIKey | ATPDRGIYVDSPCO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|