C29H37FN4O3S — CID 170178588
N-[3-(5-azaspiro[2.4]heptan-5-yl)-4-(fluoromethoxy)phenyl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylbenzamide (PubChem CID 170178588) has the molecular formula C29H37FN4O3S and a molecular weight of 540.71 g/mol. Its IUPAC name is N-[3-(5-azaspiro[2.4]heptan-5-yl)-4-(fluoromethoxy)phenyl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylbenzamide.
| Compound Name | N-[3-(5-azaspiro[2.4]heptan-5-yl)-4-(fluoromethoxy)phenyl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 170178588 |
| Molecular Formula | C29H37FN4O3S |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[3-(5-azaspiro[2.4]heptan-5-yl)-4-(fluoromethoxy)phenyl]-2-(6-azaspiro[2.5]octan-6-yl)-4-(2-hydroxyethylamino)sulfanylbenzamide |
| SMILES | O=C(Nc1ccc(OCF)c(N2CCC3(CC3)C2)c1)c1ccc(SNCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C29H37FN4O3S/c30-20-37-26-4-1-21(17-25(26)34-15-11-29(19-34)7-8-29)32-27(36)23-3-2-22(38-31-12-16-35)18-24(23)33-13-9-28(5-6-28)10-14-33/h1-4,17-18,31,35H,5-16,19-20H2,(H,32,36) |
| InChIKey | MZUNDPFNTUXKGO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|