C30H34F2N4O3S — CID 176805062
2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-[(1-ethynylcyclopropyl)sulfonylamino]benzamide (PubChem CID 176805062) has the molecular formula C30H34F2N4O3S and a molecular weight of 568.69 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-[(1-ethynylcyclopropyl)sulfonylamino]benzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-[(1-ethynylcyclopropyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 176805062 |
| Molecular Formula | C30H34F2N4O3S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-[(1-ethynylcyclopropyl)sulfonylamino]benzamide |
| SMILES | C#CC1(S(=O)(=O)Nc2ccc(C(=O)Nc3cccc(N4CCC(F)(F)CC4)c3)c(N3CCC4(CC3)CC4)c2)CC1 |
| InChI | InChI=1S/C30H34F2N4O3S/c1-2-29(10-11-29)40(38,39)34-23-6-7-25(26(21-23)36-16-12-28(8-9-28)13-17-36)27(37)33-22-4-3-5-24(20-22)35-18-14-30(31,32)15-19-35/h1,3-7,20-21,34H,8-19H2,(H,33,37) |
| InChIKey | WJLVRWHQPQFZGH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|