C29H31F2N3O4S — CID 172609675
2-(4-cyclopropylphenyl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfonylamino)benzamide (PubChem CID 172609675) has the molecular formula C29H31F2N3O4S and a molecular weight of 555.65 g/mol. Its IUPAC name is 2-(4-cyclopropylphenyl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfonylamino)benzamide.
| Compound Name | 2-(4-cyclopropylphenyl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 172609675 |
| Molecular Formula | C29H31F2N3O4S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 2-(4-cyclopropylphenyl)-N-[3-(4,4-difluoropiperidin-1-yl)phenyl]-4-(2-hydroxyethylsulfonylamino)benzamide |
| SMILES | O=C(Nc1cccc(N2CCC(F)(F)CC2)c1)c1ccc(NS(=O)(=O)CCO)cc1-c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C29H31F2N3O4S/c30-29(31)12-14-34(15-13-29)25-3-1-2-23(18-25)32-28(36)26-11-10-24(33-39(37,38)17-16-35)19-27(26)22-8-6-21(7-9-22)20-4-5-20/h1-3,6-11,18-20,33,35H,4-5,12-17H2,(H,32,36) |
| InChIKey | VANRTHKAKDWPPU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|