C23H28FN5O2 — CID 154942397
2-(6-azaspiro[2.5]octan-6-yl)-6-fluoro-N-[6-(2-methylmorpholin-4-yl)-2-pyridinyl]pyridine-3-carboxamide (PubChem CID 154942397) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-6-fluoro-N-[6-(2-methylmorpholin-4-yl)-2-pyridinyl]pyridine-3-carboxamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-6-fluoro-N-[6-(2-methylmorpholin-4-yl)-2-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154942397 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-6-fluoro-N-[6-(2-methylmorpholin-4-yl)-2-pyridinyl]pyridine-3-carboxamide |
| SMILES | CC1CN(c2cccc(NC(=O)c3ccc(F)nc3N3CCC4(CC3)CC4)n2)CCO1 |
| InChI | InChI=1S/C23H28FN5O2/c1-16-15-29(13-14-31-16)20-4-2-3-19(26-20)27-22(30)17-5-6-18(24)25-21(17)28-11-9-23(7-8-23)10-12-28/h2-6,16H,7-15H2,1H3,(H,26,27,30) |
| InChIKey | IGXHXCVEDZXNPZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|