C18H19N3O3 — CID 46484817
N-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylpyridine-3-carboxamide (PubChem CID 46484817) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylpyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46484817 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-piperidin-1-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cccnc1N1CCCCC1 |
| InChI | InChI=1S/C18H19N3O3/c22-18(20-13-6-7-15-16(11-13)24-12-23-15)14-5-4-8-19-17(14)21-9-2-1-3-10-21/h4-8,11H,1-3,9-10,12H2,(H,20,22) |
| InChIKey | PIAFRYBVZZXBGH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |