C13H11N3O3 — CID 104740959
3-amino-N-(1,3-benzodioxol-5-yl)pyridine-2-carboxamide (PubChem CID 104740959) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-amino-N-(1,3-benzodioxol-5-yl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(1,3-benzodioxol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104740959 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-amino-N-(1,3-benzodioxol-5-yl)pyridine-2-carboxamide |
| SMILES | Nc1cccnc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H11N3O3/c14-9-2-1-5-15-12(9)13(17)16-8-3-4-10-11(6-8)19-7-18-10/h1-6H,7,14H2,(H,16,17) |
| InChIKey | REFRFDLKIUIKTN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |