C14H13FN4O2 — CID 104741465
N-(3-acetamido-4-fluorophenyl)-3-aminopyridine-2-carboxamide (PubChem CID 104741465) has the molecular formula C14H13FN4O2 and a molecular weight of 288.28 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-3-aminopyridine-2-carboxamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-3-aminopyridine-2-carboxamide |
|---|---|
| PubChem CID | 104741465 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-3-aminopyridine-2-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)c2ncccc2N)ccc1F |
| InChI | InChI=1S/C14H13FN4O2/c1-8(20)18-12-7-9(4-5-10(12)15)19-14(21)13-11(16)3-2-6-17-13/h2-7H,16H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | OGANKOKATAOMGM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |