C11H9FN4O — CID 107594913
3-amino-N-(3-fluoro-4-pyridinyl)pyridine-2-carboxamide (PubChem CID 107594913) has the molecular formula C11H9FN4O and a molecular weight of 232.22 g/mol. Its IUPAC name is 3-amino-N-(3-fluoro-4-pyridinyl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(3-fluoro-4-pyridinyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107594913 |
| Molecular Formula | C11H9FN4O |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-amino-N-(3-fluoro-4-pyridinyl)pyridine-2-carboxamide |
| SMILES | Nc1cccnc1C(=O)Nc1ccncc1F |
| InChI | InChI=1S/C11H9FN4O/c12-7-6-14-5-3-9(7)16-11(17)10-8(13)2-1-4-15-10/h1-6H,13H2,(H,14,16,17) |
| InChIKey | YOLFNBTXYLHZOR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |