C16H17N3O3 — CID 84574949
N-(1,3-benzodioxol-5-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide (PubChem CID 84574949) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84574949 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide |
| SMILES | CC(C)Nc1ncccc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H17N3O3/c1-10(2)18-15-12(4-3-7-17-15)16(20)19-11-5-6-13-14(8-11)22-9-21-13/h3-8,10H,9H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | KFMLYURYXPJCNE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |