C17H12N2O3S — CID 110650976
N-(1,3-benzodioxol-5-yl)-5-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 110650976) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110650976 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ncsc1-c1ccccc1 |
| InChI | InChI=1S/C17H12N2O3S/c20-17(19-12-6-7-13-14(8-12)22-10-21-13)15-16(23-9-18-15)11-4-2-1-3-5-11/h1-9H,10H2,(H,19,20) |
| InChIKey | ZHMXICNJZXWIOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |