C24H18N2O3S — CID 24505672
N-(1,3-benzodioxol-5-yl)-2-benzyl-4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 24505672) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-benzyl-4-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-benzyl-4-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24505672 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-benzyl-4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1sc(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H18N2O3S/c27-24(25-18-11-12-19-20(14-18)29-15-28-19)23-22(17-9-5-2-6-10-17)26-21(30-23)13-16-7-3-1-4-8-16/h1-12,14H,13,15H2,(H,25,27) |
| InChIKey | NDNQMFAIOLYKLQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |