C20H17FN2O2S2 — CID 8730858
ethyl 2-[(2-fluorophenyl)carbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 8730858) has the molecular formula C20H17FN2O2S2 and a molecular weight of 400.50 g/mol. Its IUPAC name is ethyl 2-[(2-fluorophenyl)carbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-fluorophenyl)carbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8730858 |
| Molecular Formula | C20H17FN2O2S2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | ethyl 2-[(2-fluorophenyl)carbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C20H17FN2O2S2/c1-2-25-19(24)14-12-17(13-8-4-3-5-9-13)27-18(14)23-20(26)22-16-11-7-6-10-15(16)21/h3-12H,2H2,1H3,(H2,22,23,26) |
| InChIKey | OCYPXNMLPRRZQN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|