C24H26N2O2S2 — CID 19675035
ethyl 2-[1-(3,4-dimethylphenyl)ethylcarbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 19675035) has the molecular formula C24H26N2O2S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is ethyl 2-[1-(3,4-dimethylphenyl)ethylcarbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[1-(3,4-dimethylphenyl)ethylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19675035 |
| Molecular Formula | C24H26N2O2S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | ethyl 2-[1-(3,4-dimethylphenyl)ethylcarbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)NC(C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H26N2O2S2/c1-5-28-23(27)20-14-21(18-9-7-6-8-10-18)30-22(20)26-24(29)25-17(4)19-12-11-15(2)16(3)13-19/h6-14,17H,5H2,1-4H3,(H2,25,26,29) |
| InChIKey | NENCTUYQVAXATC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|