C22H20N2O4S2 — CID 19648999
3-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)carbamothioylamino]-4-methylbenzoic acid (PubChem CID 19648999) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 3-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)carbamothioylamino]-4-methylbenzoic acid.
| Compound Name | 3-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)carbamothioylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 19648999 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 3-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)carbamothioylamino]-4-methylbenzoic acid |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)Nc1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C22H20N2O4S2/c1-3-28-21(27)16-12-18(14-7-5-4-6-8-14)30-19(16)24-22(29)23-17-11-15(20(25)26)10-9-13(17)2/h4-12H,3H2,1-2H3,(H,25,26)(H2,23,24,29) |
| InChIKey | BJPDEENKZNMHAE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|