C22H30N2O2S2 — CID 19653523
ethyl 2-[di(butan-2-yl)carbamothioylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 19653523) has the molecular formula C22H30N2O2S2 and a molecular weight of 418.63 g/mol. Its IUPAC name is ethyl 2-[di(butan-2-yl)carbamothioylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[di(butan-2-yl)carbamothioylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19653523 |
| Molecular Formula | C22H30N2O2S2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 2-[di(butan-2-yl)carbamothioylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)N(C(C)CC)C(C)CC |
| InChI | InChI=1S/C22H30N2O2S2/c1-6-15(4)24(16(5)7-2)22(27)23-20-18(21(25)26-8-3)14-19(28-20)17-12-10-9-11-13-17/h9-16H,6-8H2,1-5H3,(H,23,27) |
| InChIKey | ALTJXRDAXZMRMX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|