C27H24N2O2S2 — CID 19678448
ethyl 2-[[benzyl(phenyl)carbamothioyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 19678448) has the molecular formula C27H24N2O2S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is ethyl 2-[[benzyl(phenyl)carbamothioyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[benzyl(phenyl)carbamothioyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678448 |
| Molecular Formula | C27H24N2O2S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | ethyl 2-[[benzyl(phenyl)carbamothioyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=S)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O2S2/c1-2-31-26(30)23-18-24(21-14-8-4-9-15-21)33-25(23)28-27(32)29(22-16-10-5-11-17-22)19-20-12-6-3-7-13-20/h3-18H,2,19H2,1H3,(H,28,32) |
| InChIKey | RDOXFVWMBNVIGJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|