C15H10F2N4OS — CID 166963075
1-(3,4-difluorophenyl)-3-(5-pyridin-4-yl-1,3-thiazol-2-yl)urea (PubChem CID 166963075) has the molecular formula C15H10F2N4OS and a molecular weight of 332.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(5-pyridin-4-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(5-pyridin-4-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 166963075 |
| Molecular Formula | C15H10F2N4OS |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(5-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1ncc(-c2ccncc2)s1 |
| InChI | InChI=1S/C15H10F2N4OS/c16-11-2-1-10(7-12(11)17)20-14(22)21-15-19-8-13(23-15)9-3-5-18-6-4-9/h1-8H,(H2,19,20,21,22) |
| InChIKey | PUHZAVGLXHLMOS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |