C18H13N3OS2 — CID 22559487
1-(1-benzothiophen-2-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 22559487) has the molecular formula C18H13N3OS2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1-benzothiophen-2-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 22559487 |
| Molecular Formula | C18H13N3OS2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1cc2ccccc2s1)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H13N3OS2/c22-17(20-16-10-13-8-4-5-9-14(13)23-16)21-18-19-11-15(24-18)12-6-2-1-3-7-12/h1-11H,(H2,19,20,21,22) |
| InChIKey | LLQKUUZJGMWJHM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |