C19H16N4OS — CID 150015699
1-(1-benzothiophen-2-yl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea (PubChem CID 150015699) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea.
| Compound Name | 1-(1-benzothiophen-2-yl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 150015699 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cc3ccccc3s2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H16N4OS/c1-13-11-17(23(22-13)15-8-3-2-4-9-15)20-19(24)21-18-12-14-7-5-6-10-16(14)25-18/h2-12H,1H3,(H2,20,21,24) |
| InChIKey | DEFHIFGIHBNVLZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |