C17H14F2N4O — CID 56642816
1-(3,4-difluorophenyl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea (PubChem CID 56642816) has the molecular formula C17H14F2N4O and a molecular weight of 328.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 56642816 |
| Molecular Formula | C17H14F2N4O |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(5-methyl-2-phenylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(F)c(F)c2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H14F2N4O/c1-11-9-16(23(22-11)13-5-3-2-4-6-13)21-17(24)20-12-7-8-14(18)15(19)10-12/h2-10H,1H3,(H2,20,21,24) |
| InChIKey | IEKSMUSSYJUQMY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |