C16H13F2N5O — CID 71812408
1-(3,4-difluorophenyl)-3-(5-methyl-2-pyridin-4-ylpyrazol-3-yl)urea (PubChem CID 71812408) has the molecular formula C16H13F2N5O and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(5-methyl-2-pyridin-4-ylpyrazol-3-yl)urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(5-methyl-2-pyridin-4-ylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 71812408 |
| Molecular Formula | C16H13F2N5O |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(5-methyl-2-pyridin-4-ylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(F)c(F)c2)n(-c2ccncc2)n1 |
| InChI | InChI=1S/C16H13F2N5O/c1-10-8-15(23(22-10)12-4-6-19-7-5-12)21-16(24)20-11-2-3-13(17)14(18)9-11/h2-9H,1H3,(H2,20,21,24) |
| InChIKey | JKIMRYPNCLSUKU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |