C18H15F2N3O — CID 26245099
N-(3,4-difluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 26245099) has the molecular formula C18H15F2N3O and a molecular weight of 327.33 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 26245099 |
| Molecular Formula | C18H15F2N3O |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H15F2N3O/c1-11-17(12(2)23(22-11)14-6-4-3-5-7-14)18(24)21-13-8-9-15(19)16(20)10-13/h3-10H,1-2H3,(H,21,24) |
| InChIKey | XYMRCVQXPRUIAT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |