C20H16F2N2O — CID 52753952
(E)-3-(3,4-difluorophenyl)-1-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 52753952) has the molecular formula C20H16F2N2O and a molecular weight of 338.36 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)-1-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-difluorophenyl)-1-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52753952 |
| Molecular Formula | C20H16F2N2O |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (E)-3-(3,4-difluorophenyl)-1-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)/C=C/c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H16F2N2O/c1-13-20(14(2)24(23-13)16-6-4-3-5-7-16)19(25)11-9-15-8-10-17(21)18(22)12-15/h3-12H,1-2H3/b11-9+ |
| InChIKey | ZOABXVHCPGIFBJ-PKNBQFBNSA-N |
| XLogP | 4.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|