C11H10FN3O — CID 121222038
5-fluoro-3-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 121222038) has the molecular formula C11H10FN3O and a molecular weight of 219.22 g/mol. Its IUPAC name is 5-fluoro-3-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-fluoro-3-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121222038 |
| Molecular Formula | C11H10FN3O |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-fluoro-3-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(F)c1C(N)=O |
| InChI | InChI=1S/C11H10FN3O/c1-7-9(11(13)16)10(12)15(14-7)8-5-3-2-4-6-8/h2-6H,1H3,(H2,13,16) |
| InChIKey | RPIUEASNZVPTOM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |