C25H27FN4O — CID 19331528
(E)-1-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 19331528) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is (E)-1-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19331528 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (E)-1-[4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN1CCN(C(=O)/C=C/c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H27FN4O/c1-19-24(20(2)30(27-19)23-6-4-3-5-7-23)18-28-14-16-29(17-15-28)25(31)13-10-21-8-11-22(26)12-9-21/h3-13H,14-18H2,1-2H3/b13-10+ |
| InChIKey | CRLLEMSKRZDJBS-JLHYYAGUSA-N |
| XLogP | 3.99 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|