C18H20FN3OS — CID 34976061
(E)-3-(4-fluorophenyl)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 34976061) has the molecular formula C18H20FN3OS and a molecular weight of 345.44 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 34976061 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nc(CN2CCN(C(=O)/C=C/c3ccc(F)cc3)CC2)cs1 |
| InChI | InChI=1S/C18H20FN3OS/c1-14-20-17(13-24-14)12-21-8-10-22(11-9-21)18(23)7-4-15-2-5-16(19)6-3-15/h2-7,13H,8-12H2,1H3/b7-4+ |
| InChIKey | GGIHPZKGAKQMRP-QPJJXVBHSA-N |
| XLogP | 2.95 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|